| Product Name | 2,6-Octadienal, 3,7-dimethyl-, reaction products with Me Et ketone and methanol, by-products from, distn. residues |
| CAS No. | 68815-53-2 |
| Synonyms | 2,6-Octadienal, 3,7-dimethyl-, reaction products with Me Et ketoneand methanol, by-products from, distn. residues; butan-2-one; (2E)-3,7-dimethylocta-2,6-dienal; methanol |
| InChI | InChI=1/C10H16O.C4H8O.CH4O/c1-9(2)5-4-6-10(3)7-8-11;1-3-4(2)5;1-2/h5,7-8H,4,6H2,1-3H3;3H2,1-2H3;2H,1H3/b10-7+;; |
| Molecular Formula | C15H28O3 |
| Molecular Weight | 256.381 |
| Boiling point | 229°C at 760 mmHg |
| Flash point | 101.7°C |
68815-53-2 2,6-octadienal, 3,7-dimethyl-, reaction products with me et ketone and methanol, by-produ
service@apichina.com