| Product Name | 2-[(6-methoxy-3-nitro-2-pyridyl)thio]propanoic acid |
| CAS No. | 175205-01-3 |
| Synonyms | 2-[(6-methoxy-3-nitropyridin-2-yl)sulfanyl]propanoic acid |
| InChI | InChI=1/C9H10N2O5S/c1-5(9(12)13)17-8-6(11(14)15)3-4-7(10-8)16-2/h3-5H,1-2H3,(H,12,13) |
| Molecular Formula | C9H10N2O5S |
| Molecular Weight | 258.2511 |
| Density | 1.47g/cm3 |
| Melting point | 196℃ |
| Boiling point | 434.5°C at 760 mmHg |
| Flash point | 216.6°C |
| Refractive index | 1.605 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
175205-01-3 2-[(6-methoxy-3-nitro-2-pyridyl)thio]propanoic acid
service@apichina.com