| Product Name | 2,6-Lutidine-N-oxide |
| CAS No. | 1073-23-0 |
| Synonyms | 2,6-Dimethylpyridine N-oxide; 2,6-Lutidine N-oxide; LutidineNoxide; 2,6-dimethylpyridine 1-oxide; 2,6-dimethyl-1-oxo-1,2-dihydropyridinium |
| InChI | InChI=1/C7H10NO/c1-6-4-3-5-7(2)8(6)9/h3-6H,1-2H3/q+1 |
| Molecular Formula | C7H10NO |
| Molecular Weight | 124.1599 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
1073-23-0 2,6-lutidine-n-oxide
service@apichina.com