| Product Name | 2,6-Dimethylquinoline |
| CAS No. | 877-43-0 |
| Synonyms | 6-METHYLQUINALDINE; 2,6-dimethyl-quinolin; P-TOLUQUINALDINE; Quinoline, 2,6-dimethyl- |
| InChI | InChI=1/C11H11N/c1-8-3-6-11-10(7-8)5-4-9(2)12-11/h3-7H,1-2H3 |
| Molecular Formula | C11H11N |
| Molecular Weight | 157.2117 |
| Density | 1.052g/cm3 |
| Melting point | 56-60 °C |
| Boiling point | 266.5°C at 760 mmHg |
| Flash point | 106.5°C |
| Refractive index | 1.61 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
877-43-0 2,6-dimethylquinoline
service@apichina.com