| Product Name | 2,6-Dimethylphenyl isothiocyanate |
| CAS No. | 19241-16-8 |
| Synonyms | 2,6-Dimethylisothiocyanatobenzene; 2-isothiocyanato-1,3-dimethylbenzene |
| InChI | InChI=1/C9H9NS/c1-7-4-3-5-8(2)9(7)10-6-11/h3-5H,1-2H3 |
| Molecular Formula | C9H9NS |
| Molecular Weight | 163.2395 |
| Density | 1.01g/cm3 |
| Boiling point | 267°C at 760 mmHg |
| Flash point | 116.7°C |
| Refractive index | 1.554 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
19241-16-8 2,6-dimethylphenyl isothiocyanate
service@apichina.com