| Product Name | 2,6-Dimethylcyclohexanol, mixture of isomers |
| CAS No. | 5337-72-4 |
| Synonyms | 2,6-Dimethylcyclohexan-1-ol; 2,6-dimethylcyclohexanol; (2R,6S)-2,6-dimethylcyclohexanol; (2R,6R)-2,6-dimethylcyclohexanol; (2S,6S)-2,6-dimethylcyclohexanol; (1s,2R,6S)-2,6-dimethylcyclohexanol |
| InChI | InChI=1/C8H16O/c1-6-4-3-5-7(2)8(6)9/h6-9H,3-5H2,1-2H3/t6-,7+,8- |
| Molecular Formula | C8H16O |
| Molecular Weight | 128.212 |
| Density | 0.894g/cm3 |
| Boiling point | 174.499°C at 760 mmHg |
| Flash point | 55°C |
| Refractive index | 1.452 |
| Risk Codes | R10:Flammable.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; |
5337-72-4 2,6-dimethylcyclohexanol, mixture of isomers
service@apichina.com