| Product Name | 2,6-Dimethylbenzoquinone |
| CAS No. | 527-61-7 |
| InChI | InChI=1/C8H8O2/c1-5-3-7(9)4-6(2)8(5)10/h3-4H,1-2H3 |
| Molecular Formula | C8H8O2 |
| Molecular Weight | 136.15 |
| Melting point | 69-74℃ |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
527-61-7 2,6-dimethylbenzoquinone
service@apichina.com