| Product Name | 2,6-Dimethoxybenzonitrile |
| CAS No. | 16932-49-3 |
| Synonyms | Benzonitrile, 2,6-dimethoxy-; 2-10-00-00260 (Beilstein Handbook Reference); BRN 2720059 |
| InChI | InChI=1/C9H9NO2/c1-11-8-4-3-5-9(12-2)7(8)6-10/h3-5H,1-2H3 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.1733 |
| Density | 1.12g/cm3 |
| Melting point | 119-123℃ |
| Boiling point | 306.7°C at 760 mmHg |
| Flash point | 128.8°C |
| Refractive index | 1.519 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
16932-49-3 2,6-dimethoxybenzonitrile
service@apichina.com