| Product Name | 2,6-Dimethoxy-3-nitrobenzoic acid |
| CAS No. | 55776-17-5 |
| InChI | InChI=1/C9H9NO6/c1-15-6-4-3-5(10(13)14)8(16-2)7(6)9(11)12/h3-4H,1-2H3,(H,11,12) |
| Molecular Formula | C9H9NO6 |
| Molecular Weight | 227.1709 |
| Density | 1.403g/cm3 |
| Boiling point | 420.7°C at 760 mmHg |
| Flash point | 208.2°C |
| Refractive index | 1.569 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
55776-17-5 2,6-dimethoxy-3-nitrobenzoic acid
service@apichina.com