| Product Name | 2,6-Diiodo-p-benzoquinone |
| CAS No. | 20389-01-9 |
| Synonyms | 2,6-Diiodoquinone; 2,6-diiodocyclohexa-2,5-diene-1,4-dione |
| InChI | InChI=1/C6H2I2O2/c7-4-1-3(9)2-5(8)6(4)10/h1-2H |
| Molecular Formula | C6H2I2O2 |
| Molecular Weight | 359.8878 |
| Density | 2.76g/cm3 |
| Boiling point | 312.8°C at 760 mmHg |
| Flash point | 143°C |
| Refractive index | 1.754 |
| Risk Codes | R20/22:Harmful by inhalation and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
20389-01-9 2,6-diiodo-p-benzoquinone
service@apichina.com