| Product Name | 2,6-Diiodo-4-nitroaniline |
| CAS No. | 5398-27-6 |
| Synonyms | 1-(3-methylphenyl)-2,3,4,9-tetrahydro-1H-beta-carboline |
| InChI | InChI=1/C18H18N2/c1-12-5-4-6-13(11-12)17-18-15(9-10-19-17)14-7-2-3-8-16(14)20-18/h2-8,11,17,19-20H,9-10H2,1H3 |
| Molecular Formula | C18H18N2 |
| Molecular Weight | 262.3489 |
| Density | 1.165g/cm3 |
| Melting point | 251-256℃ |
| Boiling point | 455.4°C at 760 mmHg |
| Flash point | 229.2°C |
| Refractive index | 1.661 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
5398-27-6 2,6-diiodo-4-nitroaniline
service@apichina.com