| Product Name | 2,6-Dihydroxybenzamide |
| CAS No. | 3147-50-0 |
| InChI | InChI=1/C7H7NO3/c8-7(11)6-4(9)2-1-3-5(6)10/h1-3,9-10H,(H2,8,11) |
| Molecular Formula | C7H7NO3 |
| Molecular Weight | 153.1354 |
| Density | 1.458g/cm3 |
| Boiling point | 357.6°C at 760 mmHg |
| Flash point | 170.1°C |
| Refractive index | 1.664 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
3147-50-0 2,6-dihydroxybenzamide
service@apichina.com