| Product Name | 2,6-Dihydroxyanthraquinone |
| CAS No. | 84-60-6 |
| InChI | InChI=1/C14H8O4/c15-7-1-3-9-11(5-7)14(18)10-4-2-8(16)6-12(10)13(9)17/h1-6,15-16H |
| Molecular Formula | C14H8O4 |
| Molecular Weight | 240.2109 |
| Density | 1.54g/cm3 |
| Melting point | 320℃ |
| Boiling point | 442.1°C at 760 mmHg |
| Flash point | 235.3°C |
| Refractive index | 1.732 |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
84-60-6 2,6-dihydroxyanthraquinone
service@apichina.com
- Next:145171-22-8 asc10 protein
- Previous:145170-92-9 leucocin a-ual 187