| Product Name | 2,6-dihydroxy-3-nitrobenzonitrile |
| CAS No. | 233585-04-1 |
| InChI | InChI=1/C7H4N2O4/c8-3-4-6(10)2-1-5(7(4)11)9(12)13/h1-2,10-11H |
| Molecular Formula | C7H4N2O4 |
| Molecular Weight | 180.1177 |
| Density | 1.69g/cm3 |
| Melting point | 238℃ |
| Boiling point | 358.2°C at 760 mmHg |
| Flash point | 170.5°C |
| Refractive index | 1.683 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
233585-04-1 2,6-dihydroxy-3-nitrobenzonitrile
service@apichina.com