| Product Name | 2,6-difluoromandelic acid |
| CAS No. | 207981-50-8 |
| Synonyms | alpha-Hydroxy-2,6-difluorophenylacetic acid; (2,6-difluorophenyl)(hydroxy)acetic acid |
| InChI | InChI=1/C8H6F2O3/c9-4-2-1-3-5(10)6(4)7(11)8(12)13/h1-3,7,11H,(H,12,13) |
| Molecular Formula | C8H6F2O3 |
| Molecular Weight | 188.1282 |
| Density | 1.522g/cm3 |
| Boiling point | 299.3°C at 760 mmHg |
| Flash point | 134.8°C |
| Refractive index | 1.542 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
207981-50-8 2,6-difluoromandelic acid
service@apichina.com