| Product Name | 2,6-Difluorobutyrophenone |
| CAS No. | 95727-77-8 |
| Synonyms | 1-(2,6-difluorophenyl)butan-1-one |
| InChI | InChI=1/C10H10F2O/c1-2-4-9(13)10-7(11)5-3-6-8(10)12/h3,5-6H,2,4H2,1H3 |
| Molecular Formula | C10H10F2O |
| Molecular Weight | 184.1826 |
| Density | 1.134g/cm3 |
| Boiling point | 219.6°C at 760 mmHg |
| Flash point | 82.6°C |
| Refractive index | 1.472 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
95727-77-8 2,6-difluorobutyrophenone
service@apichina.com