| Product Name | 2,6-Difluoro-3-nitrobenzonitrile |
| CAS No. | 143879-77-0 |
| InChI | InChI=1/C7H2F2N2O2/c8-5-1-2-6(11(12)13)7(9)4(5)3-10/h1-2H |
| Molecular Formula | C7H2F2N2O2 |
| Molecular Weight | 184.0998 |
| Density | 1.51g/cm3 |
| Boiling point | 263.7°C at 760 mmHg |
| Flash point | 113.3°C |
| Refractive index | 1.529 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
143879-77-0 2,6-difluoro-3-nitrobenzonitrile
service@apichina.com