| Product Name | 2,6-diethylphenyl isocyanate |
| CAS No. | 20458-99-5 |
| Synonyms | 2,6-Diethylisocyanatobenzene; 1,3-diethyl-2-isocyanatobenzene |
| InChI | InChI=1/C11H13NO/c1-3-9-6-5-7-10(4-2)11(9)12-8-13/h5-7H,3-4H2,1-2H3 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.227 |
| Density | 0.96g/cm3 |
| Boiling point | 259.8°C at 760 mmHg |
| Flash point | 93.8°C |
| Refractive index | 1.509 |
| Risk Codes | R23/25:Toxic by inhalation and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; R42:May cause sensitization by inhalation.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
20458-99-5 2,6-diethylphenyl isocyanate
service@apichina.com