| Product Name | 2,6-dichloropyridine-4-carbothioamide |
| CAS No. | 175204-46-3 |
| InChI | InChI=1/C6H4Cl2N2S/c7-4-1-3(6(9)11)2-5(8)10-4/h1-2H,(H2,9,11) |
| Molecular Formula | C6H4Cl2N2S |
| Molecular Weight | 207.0804 |
| Density | 1.555g/cm3 |
| Melting point | 145℃ |
| Boiling point | 366.5°C at 760 mmHg |
| Flash point | 175.5°C |
| Refractive index | 1.68 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R22:Harmful if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
175204-46-3 2,6-dichloropyridine-4-carbothioamide
service@apichina.com