| Product Name | 2,6-Dichloropyridine-4-carbonyl chloride |
| CAS No. | 42521-08-4 |
| Synonyms | 2,6-Dichloropyridine-4-carboxylic chloride |
| InChI | InChI=1/C6H2Cl3NO/c7-4-1-3(6(9)11)2-5(8)10-4/h1-2H |
| Molecular Formula | C6H2Cl3NO |
| Molecular Weight | 210.4452 |
| Density | 1.582g/cm3 |
| Boiling point | 280.4°C at 760 mmHg |
| Flash point | 123.4°C |
| Refractive index | 1.582 |
| Hazard Symbols | |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
42521-08-4 2,6-dichloropyridine-4-carbonyl chloride
service@apichina.com