| Product Name | 2,6-Dichloronitrosobenzene |
| CAS No. | 1194-66-7 |
| Synonyms | 1,3-dichloro-2-nitrosobenzene |
| InChI | InChI=1/C6H3Cl2NO/c7-4-2-1-3-5(8)6(4)9-10/h1-3H |
| Molecular Formula | C6H3Cl2NO |
| Molecular Weight | 176.0001 |
| Density | 1.45g/cm3 |
| Boiling point | 271.9°C at 760 mmHg |
| Flash point | 120.5°C |
| Refractive index | 1.588 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
1194-66-7 2,6-dichloronitrosobenzene
service@apichina.com