| Product Name | 2,6-dichloro-4-(chloromethyl)pyridine |
| CAS No. | 101990-72-1 |
| InChI | InChI=1/C6H4Cl3N/c7-3-4-1-5(8)10-6(9)2-4/h1-2H,3H2 |
| Molecular Formula | C6H4Cl3N |
| Molecular Weight | 196.4617 |
| Density | 1.463g/cm3 |
| Boiling point | 287.4°C at 760 mmHg |
| Flash point | 155°C |
| Refractive index | 1.567 |
| Hazard Symbols | |
| Risk Codes | R22:Harmful if swallowed.; R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
101990-72-1 2,6-dichloro-4-(chloromethyl)pyridine
service@apichina.com