| Product Name | 2,6-Dibromotoluene |
| CAS No. | 69321-60-4 |
| Synonyms | 1,3-dibromo-2-methylbenzene |
| InChI | InChI=1/C7H6Br2/c1-5-6(8)3-2-4-7(5)9/h2-4H,1H3 |
| Molecular Formula | C7H6Br2 |
| Molecular Weight | 249.9305 |
| Density | 1.81g/cm3 |
| Boiling point | 246°C at 760 mmHg |
| Flash point | 106.6°C |
| Refractive index | 1.587 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
69321-60-4 2,6-dibromotoluene
service@apichina.com