| Product Name | 2,6-Dibromo-4-nitrotoluene |
| CAS No. | 110127-07-6 |
| Synonyms | 1,3-dibromo-2-methyl-5-nitrobenzene |
| InChI | InChI=1/C7H5Br2NO2/c1-4-6(8)2-5(10(11)12)3-7(4)9/h2-3H,1H3 |
| Molecular Formula | C7H5Br2NO2 |
| Molecular Weight | 294.9281 |
| Density | 1.967g/cm3 |
| Boiling point | 320.4°C at 760 mmHg |
| Flash point | 147.6°C |
| Refractive index | 1.625 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
110127-07-6 2,6-dibromo-4-nitrotoluene
service@apichina.com