| Product Name | 2,6-di(oxiran-2-ylmethyl)-1,2,3,5,6,7-hexahydropyrrolo[3,4-f]isoindole-1,3,5,7-tetraone |
| CAS No. | 23328-66-7 |
| Synonyms | 2,6-Di(oxiran-2-ylmethyl)-1,2,3,5,6,7-hexahydropyrrolo[3,4-f]isoindole-1,3,5,7-tetra; 2,6-bis(oxiran-2-ylmethyl)pyrrolo[3,4-f]isoindole-1,3,5,7(2H,6H)-tetrone |
| InChI | InChI=1/C16H12N2O6/c19-13-9-1-10-12(16(22)18(14(10)20)4-8-6-24-8)2-11(9)15(21)17(13)3-7-5-23-7/h1-2,7-8H,3-6H2 |
| Molecular Formula | C16H12N2O6 |
| Molecular Weight | 328.2763 |
| Density | 1.713g/cm3 |
| Boiling point | 570.4°C at 760 mmHg |
| Flash point | 298.8°C |
| Refractive index | 1.725 |
| Hazard Symbols | |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
23328-66-7 2,6-di(oxiran-2-ylmethyl)-1,2,3,5,6,7-hexahydropyrrolo[3,4-f]isoindole-1,3,5,7-tetraone
service@apichina.com