| Product Name | 2,5-Diphenyl-p-benzoquinone |
| CAS No. | 844-51-9 |
| Synonyms | 2,5-Diphenyl-4-benzoquinone; 2,5-Diphenyl-1,4-benzoquinone; AI3-61046; NSC 8725; 2,5-Cyclohexadiene-1,4-dione, 2,5-diphenyl-; p-Benzoquinone, 2,5-diphenyl- (8CI); 2,5-diphenylcyclohexa-2,5-diene-1,4-dione |
| InChI | InChI=1/C18H12O2/c19-17-12-16(14-9-5-2-6-10-14)18(20)11-15(17)13-7-3-1-4-8-13/h1-12H |
| Molecular Formula | C18H12O2 |
| Molecular Weight | 260.2867 |
| Density | 1.237g/cm3 |
| Boiling point | 457.9°C at 760 mmHg |
| Flash point | 170.5°C |
| Refractive index | 1.642 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
844-51-9 2,5-diphenyl-p-benzoquinone
service@apichina.com