| Product Name | 2,5-dinitrobenzoic acid |
| CAS No. | 610-28-6 |
| Synonyms | 2,5-Dinitrobenzoic acid; 4-09-00-01241 (Beilstein Handbook Reference); BRN 1983247; CCRIS 3127; NSC 3810; Benzoic acid, 2,5-dinitro-; 2,5-dinitrobenzoate |
| InChI | InChI=1/C7H4N2O6/c10-7(11)5-3-4(8(12)13)1-2-6(5)9(14)15/h1-3H,(H,10,11)/p-1 |
| Molecular Formula | C7H3N2O6 |
| Molecular Weight | 211.1091 |
| Melting point | 180℃ |
| Boiling point | 419.6°C at 760 mmHg |
| Flash point | 190.5°C |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
610-28-6 2,5-dinitrobenzoic acid
service@apichina.com
- Next:610-29-7 nitroterephthalic acid
- Previous:610-27-5 4-nitrophthalic acid