| Product Name | 2,5-Dimethyltetrahydrofuran, mixture of cis and trans |
| CAS No. | 1003-38-9 |
| Synonyms | 2,5-DIMETHYLTETRAHYDROFURAN |
| InChI | InChI=1/C6H12O/c1-5-3-4-6(2)7-5/h5-6H,3-4H2,1-2H3/t5-,6-/m0/s1 |
| Molecular Formula | C6H12O |
| Molecular Weight | 100.1589 |
| Density | 0.836g/cm3 |
| Melting point | -45℃ |
| Boiling point | 91°C at 760 mmHg |
| Flash point | 26.7°C |
| Refractive index | 1.406 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R10:Flammable.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S24/25:Avoid contact with skin and eyes.; |
1003-38-9 2,5-dimethyltetrahydrofuran, mixture of cis and trans
service@apichina.com