| Product Name | 2,5-Dimethylstyrene |
| CAS No. | 2039-89-6 |
| Synonyms | Styrene, 2,5-dimethyl-; 1,4-Dimethyl-2-ethenylbenzene; 1,4-Dimethyl-2-vinylbenzene; 4-05-00-01385 (Beilstein Handbook Reference); BRN 2203656; NSC 73477; Benzene, 2-ethenyl-1,4-dimethyl- (9CI); 2-ethenyl-1,4-dimethylbenzene |
| InChI | InChI=1/C10H12/c1-4-10-7-8(2)5-6-9(10)3/h4-7H,1H2,2-3H3 |
| Molecular Formula | C10H12 |
| Molecular Weight | 132.2023 |
| Density | 0.893g/cm3 |
| Boiling point | 194.1°C at 760 mmHg |
| Flash point | 58.8°C |
| Refractive index | 1.545 |
| Risk Codes | R36/37:Irritating to eyes and respiratory system.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
2039-89-6 2,5-dimethylstyrene
service@apichina.com