| Product Name | 2,5-Dimethylresorcinol |
| CAS No. | 488-87-9 |
| Synonyms | 2,5-dimethylbenzene-1,3-diol |
| InChI | InChI=1/C8H10O2/c1-5-3-7(9)6(2)8(10)4-5/h3-4,9-10H,1-2H3 |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 138.1638 |
| Density | 1.162g/cm3 |
| Melting point | 161℃ |
| Boiling point | 284.1°C at 760 mmHg |
| Flash point | 140.8°C |
| Refractive index | 1.582 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
488-87-9 2,5-dimethylresorcinol
service@apichina.com