| Product Name | 2,5-Dimethylpyrrolidine, mixture of cis and trans |
| CAS No. | 3378-71-0 |
| Synonyms | 2,5-Dimethylpyrrolidine; (2R,5S)-2,5-dimethylpyrrolidinium; (2R,5R)-2,5-dimethylpyrrolidinium; (2S,5S)-2,5-dimethylpyrrolidinium |
| InChI | InChI=1/C6H13N/c1-5-3-4-6(2)7-5/h5-7H,3-4H2,1-2H3/p+1/t5-,6-/m0/s1 |
| Molecular Formula | C6H14N |
| Molecular Weight | 100.1815 |
| Boiling point | 106.5°C at 760 mmHg |
| Flash point | 7.2°C |
| Hazard Symbols |  F:Flammable;  C:Corrosive; |
| Risk Codes | R11:; R34:; |
| Safety | S16:; S26:; S36/37/39:; S45:; |
3378-71-0 2,5-dimethylpyrrolidine, mixture of cis and trans
service@apichina.com