| Product Name | (2,5-dimethylphenyl)-(3-thienyl)methanone |
| CAS No. | 896618-60-3 |
| InChI | InChI=1/C13H12OS/c1-9-3-4-10(2)12(7-9)13(14)11-5-6-15-8-11/h3-8H,1-2H3 |
| Molecular Formula | C13H12OS |
| Molecular Weight | 216.2988 |
| Density | 1.14g/cm3 |
| Boiling point | 322.5°C at 760 mmHg |
| Flash point | 148.8°C |
| Refractive index | 1.591 |
896618-60-3 (2,5-dimethylphenyl)-(3-thienyl)methanone
service@apichina.com