| Product Name | 2,5-Dimethylcinnamic acid |
| CAS No. | 95883-10-6 |
| Synonyms | (2E)-3-(2,5-dimethylphenyl)prop-2-enoic acid |
| InChI | InChI=1/C11H12O2/c1-8-3-4-9(2)10(7-8)5-6-11(12)13/h3-7H,1-2H3,(H,12,13)/b6-5+ |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.2118 |
| Density | 1.118g/cm3 |
| Boiling point | 307°C at 760 mmHg |
| Flash point | 212.2°C |
| Refractive index | 1.592 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
95883-10-6 2,5-dimethylcinnamic acid
service@apichina.com