| Product Name | 2,5-Dimethylbenzothiazole |
| CAS No. | 95-26-1 |
| Synonyms | Benzothiazole, 2,5-dimethyl-; 2,5-Dimethylbenzthiazol; 2,5-Dimethylbenzthiazol [Czech]; 4-27-00-01101 (Beilstein Handbook Reference); BRN 0116455; 2,5-dimethyl-1,3-benzothiazole |
| InChI | InChI=1/C9H9NS/c1-6-3-4-9-8(5-6)10-7(2)11-9/h3-5H,1-2H3 |
| Molecular Formula | C9H9NS |
| Molecular Weight | 163.2395 |
| Density | 1.176g/cm3 |
| Melting point | 36-40℃ |
| Boiling point | 259.4°C at 760 mmHg |
| Flash point | 112.7°C |
| Refractive index | 1.643 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R22:Harmful if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
95-26-1 2,5-dimethylbenzothiazole
service@apichina.com