| Product Name | 2,5-Dimethylbenzeneboronic acid |
| CAS No. | 85199-06-0 |
| Synonyms | 2,5-Dimethylphenylboronic acid; P-XYLENE-2-BORONIC ACID |
| InChI | InChI=1/C8H11BO2/c1-6-3-4-7(2)8(5-6)9(10)11/h3-5,10-11H,1-2H3 |
| Molecular Formula | C8H11BO2 |
| Molecular Weight | 149.9827 |
| Density | 1.07g/cm3 |
| Melting point | 186-191℃ |
| Boiling point | 305.1°C at 760 mmHg |
| Flash point | 138.3°C |
| Refractive index | 1.523 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
85199-06-0 2,5-dimethylbenzeneboronic acid
service@apichina.com