| Product Name | 2,5-Dimethyl-3-pyrroline, mixture of cis and trans |
| CAS No. | 59480-92-1 |
| Synonyms | 2,5-dimethyl-3-pyrroline; 2,5-Dimethyl-2,5-dihydro-1H-pyrrole; (2R,5S)-2,5-dimethyl-2,5-dihydro-1H-pyrrolium; (2R,5R)-2,5-dimethyl-2,5-dihydro-1H-pyrrolium; (2S,5S)-2,5-dimethyl-2,5-dihydro-1H-pyrrolium |
| InChI | InChI=1/C6H11N/c1-5-3-4-6(2)7-5/h3-7H,1-2H3/p+1/t5-,6-/m0/s1 |
| Molecular Formula | C6H12N |
| Molecular Weight | 98.1656 |
| Boiling point | 124.1°C at 760 mmHg |
| Flash point | 5°C |
| Hazard Symbols | |
| Risk Codes | R11:Highly flammable.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; |
59480-92-1 2,5-dimethyl-3-pyrroline, mixture of cis and trans
service@apichina.com