| Product Name | 2,5-Dimethyl-2,4-hexadienedioic Acid |
| CAS No. | 20514-41-4 |
| Synonyms | a,a-Dimethylmuconic acid; 2,5-dimethylhexa-2,4-dienedioic acid; (2E,4E)-2,5-dimethylhexa-2,4-dienedioic acid |
| InChI | InChI=1/C8H10O4/c1-5(7(9)10)3-4-6(2)8(11)12/h3-4H,1-2H3,(H,9,10)(H,11,12)/b5-3+,6-4+ |
| Molecular Formula | C8H10O4 |
| Molecular Weight | 170.1626 |
| Density | 1.245g/cm3 |
| Boiling point | 351°C at 760 mmHg |
| Flash point | 180.3°C |
| Refractive index | 1.527 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
20514-41-4 2,5-dimethyl-2,4-hexadienedioic acid
service@apichina.com
- Next:13840-40-9 phosphineoxide
- Previous:13840-33-0 lithium hypochlorite