| Product Name | 2,5-dimethyl-1H-pyrrole-3-carboxylic acid |
| CAS No. | 57338-76-8 |
| Synonyms | 2,5-Dimethylpyrrole-3-carboxylic acid; 2,5-dimethyl-1H-pyrrole-3-carboxylate |
| InChI | InChI=1/C7H9NO2/c1-4-3-6(7(9)10)5(2)8-4/h3,8H,1-2H3,(H,9,10)/p-1 |
| Molecular Formula | C7H8NO2 |
| Molecular Weight | 138.1445 |
| Melting point | 200℃ |
| Boiling point | 318.4°C at 760 mmHg |
| Flash point | 146.4°C |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
57338-76-8 2,5-dimethyl-1h-pyrrole-3-carboxylic acid
service@apichina.com