| Product Name | 2,5-Dimethyl-1-phenylpyrrole |
| CAS No. | 83-24-9 |
| Synonyms | 1H-Pyrrole, 2,5-dimethyl-1-phenyl-; NSC 163170; 2,5-Dimethyl-1-phenyl-1H-pyrrole; Pyrrole, 2,5-dimethyl-1-phenyl- (8CI); 1-cyclohexyl-2,5-dimethyl-1H-pyrrole; 2,5-dimethyl-1-phenylpyrrolidine |
| InChI | InChI=1/C12H17N/c1-10-8-9-11(2)13(10)12-6-4-3-5-7-12/h3-7,10-11H,8-9H2,1-2H3 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.2701 |
| Density | 0.952g/cm3 |
| Melting point | 50-51℃ |
| Boiling point | 257.7°C at 760 mmHg |
| Flash point | 100.2°C |
| Refractive index | 1.519 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
83-24-9 2,5-dimethyl-1-phenylpyrrole
service@apichina.com