| Product Name | 2,5-Dimethyl-1-phenylpyrrole-3-carboxaldehyde |
| CAS No. | 83-18-1 |
| Synonyms | 1H-Pyrrole-3-carboxaldehyde, 2,5-dimethyl-1-phenyl-; NSC 68230; 2,5-Dimethyl-1-phenyl-1H-pyrrole-3-carbaldehyde; Pyrrole-3-carboxaldehyde, 2,5-dimethyl-1-phenyl- (8CI); 1-cyclohexyl-2,5-dimethyl-1H-pyrrole-3-carbaldehyde; 2,5-dimethyl-1-phenylpyrrole-3-carbaldehyde |
| InChI | InChI=1/C13H19NO/c1-10-8-12(9-15)11(2)14(10)13-6-4-3-5-7-13/h8-9,13H,3-7H2,1-2H3 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.2961 |
| Density | 1.07g/cm3 |
| Boiling point | 345.8°C at 760 mmHg |
| Flash point | 163°C |
| Refractive index | 1.559 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
83-18-1 2,5-dimethyl-1-phenylpyrrole-3-carboxaldehyde
service@apichina.com