| Product Name | 2,5-Dimethyl-1,3-oxazole-4-carboxylic acid |
| CAS No. | 23000-14-8 |
| InChI | InChI=1/C6H7NO3/c1-3-5(6(8)9)7-4(2)10-3/h1-2H3,(H,8,9) |
| Molecular Formula | C6H7NO3 |
| Molecular Weight | 141.1247 |
| Density | 1.276g/cm3 |
| Melting point | 236℃ |
| Boiling point | 267.4°C at 760 mmHg |
| Flash point | 115.5°C |
| Refractive index | 1.513 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
23000-14-8 2,5-dimethyl-1,3-oxazole-4-carboxylic acid
service@apichina.com