| Product Name | 2,5-Dimethyl-1,3,4-thiadiazole |
| CAS No. | 27464-82-0 |
| Synonyms | 1,3,4-Thiadiazole, 2,5-dimethyl-; 2,5-Dimethylthiadiazole; NSC 93787 |
| InChI | InChI=1/C4H6N2S/c1-3-5-6-4(2)7-3/h1-2H3 |
| Molecular Formula | C4H6N2S |
| Molecular Weight | 114.1688 |
| Density | 1.166g/cm3 |
| Melting point | 62-65℃ |
| Boiling point | 202.5°C at 760 mmHg |
| Flash point | 81.2°C |
| Refractive index | 1.534 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
27464-82-0 2,5-dimethyl-1,3,4-thiadiazole
service@apichina.com