| Product Name | 2,5-Dimethoxythiophenol |
| CAS No. | 1483-27-8 |
| Synonyms | 2,5-Dimethoxybenzenethiol |
| InChI | InChI=1/C8H10O2S/c1-9-6-3-4-7(10-2)8(11)5-6/h3-5,11H,1-2H3 |
| Molecular Formula | C8H10O2S |
| Molecular Weight | 170.2288 |
| Density | 1.134g/cm3 |
| Boiling point | 278.8°C at 760 mmHg |
| Flash point | 122.4°C |
| Refractive index | 1.549 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
1483-27-8 2,5-dimethoxythiophenol
service@apichina.com