| Product Name | 2,5-Dimethoxytetrahydrofuran, mixture of cis- and trans isomers |
| CAS No. | 696-59-3 |
| Synonyms | Tetrahydro-2,5-dimethoxyfuran; 2,5-Dimethoxytetrahydrofuran; (2R,5R)-2,5-dimethoxytetrahydrofuran; (2S,5S)-2,5-dimethoxytetrahydrofuran; (2R,5S)-2,5-dimethoxytetrahydrofuran |
| InChI | InChI=1/C6H12O3/c1-7-5-3-4-6(8-2)9-5/h5-6H,3-4H2,1-2H3/t5-,6+ |
| Molecular Formula | C6H12O3 |
| Molecular Weight | 132.1577 |
| Density | 1.02g/cm3 |
| Melting point | -45℃ |
| Boiling point | 145.7°C at 760 mmHg |
| Flash point | 35°C |
| Water solubility | 350 g/L (20℃) |
| Refractive index | 1.423 |
| Hazard Symbols | |
| Risk Codes | R10:; R20/21:; R36:; |
| Safety | S16:; S36/37/39:; |
696-59-3 2,5-dimethoxytetrahydrofuran, mixture of cis- and trans isomers
service@apichina.com