| Product Name | 2,5-dimethoxyphenyl isocyanate |
| CAS No. | 56309-62-7 |
| Synonyms | 2-isocyanato-1,4-dimethoxybenzene |
| InChI | InChI=1/C9H9NO3/c1-12-7-3-4-9(13-2)8(5-7)10-6-11/h3-5H,1-2H3 |
| Molecular Formula | C9H9NO3 |
| Molecular Weight | 179.1727 |
| Density | 1.1g/cm3 |
| Melting point | 40-42℃ |
| Boiling point | 279.5°C at 760 mmHg |
| Flash point | 131.6°C |
| Refractive index | 1.501 |
| Risk Codes | R20/22:Harmful by inhalation and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; R42:May cause sensitization by inhalation.; |
| Safety | S22:Do not inhale dust.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
56309-62-7 2,5-dimethoxyphenyl isocyanate
service@apichina.com