| Product Name | (2,5-dimethoxyphenyl)acetyl chloride |
| CAS No. | 52711-92-9 |
| Synonyms | o-Homoveratryl chloride |
| InChI | InChI=1/C10H11ClO3/c1-13-8-3-4-9(14-2)7(5-8)6-10(11)12/h3-5H,6H2,1-2H3 |
| Molecular Formula | C10H11ClO3 |
| Molecular Weight | 214.6455 |
| Density | 1.2g/cm3 |
| Boiling point | 312.5°C at 760 mmHg |
| Flash point | 128°C |
| Refractive index | 1.516 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
52711-92-9 (2,5-dimethoxyphenyl)acetyl chloride
service@apichina.com