| Product Name | 2,5-Dimethoxybenzonitrile |
| CAS No. | 5312-97-0 |
| Synonyms | 3-{3-methoxy-4-[(3-methylbenzyl)oxy]phenyl}-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile |
| InChI | InChI=1/C26H23N3O2/c1-17-5-4-6-20(11-17)16-31-24-10-8-19(14-25(24)30-3)13-21(15-27)26-28-22-9-7-18(2)12-23(22)29-26/h4-14H,16H2,1-3H3,(H,28,29) |
| Molecular Formula | C26H23N3O2 |
| Molecular Weight | 409.4797 |
| Density | 1.23g/cm3 |
| Melting point | 80-82℃ |
| Boiling point | 638°C at 760 mmHg |
| Flash point | 339.6°C |
| Refractive index | 1.672 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
5312-97-0 2,5-dimethoxybenzonitrile
service@apichina.com