| Product Name | 2,5-Dimethoxy-3-tetrahydrofurancarboxaldehyde, mixture of isomers |
| CAS No. | 50634-05-4 |
| Synonyms | Tetrahydro-2,5-dimethoxyfuran-3-carbaldehyde; 2,5-dimethoxytetrahydrofuran-3-carbaldehyde; (2R,3R,5S)-2,5-dimethoxytetrahydrofuran-3-carbaldehyde; (2R,3R,5R)-2,5-dimethoxytetrahydrofuran-3-carbaldehyde; (2R,3S,5S)-2,5-dimethoxytetrahydrofuran-3-carbaldehyde; (2R,3S,5R)-2,5-dimethoxytetrahydrofuran-3-carbaldehyde |
| InChI | InChI=1/C7H12O4/c1-9-6-3-5(4-8)7(10-2)11-6/h4-7H,3H2,1-2H3/t5-,6+,7+/m0/s1 |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.1678 |
| Density | 1.11g/cm3 |
| Boiling point | 206.9°C at 760 mmHg |
| Flash point | 91.6°C |
| Refractive index | 1.439 |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
50634-05-4 2,5-dimethoxy-3-tetrahydrofurancarboxaldehyde, mixture of isomers
service@apichina.com