| Product Name | 2,5-Dihydroxy-1,4-benzoquinone |
| CAS No. | 615-94-1 |
| Synonyms | 2,5-Dihydroxybenzoquinone; 2,5-dihydroxycyclohexa-2,5-diene-1,4-dione |
| InChI | InChI=1/C6H4O4/c7-3-1-4(8)6(10)2-5(3)9/h1-2,7,10H |
| Molecular Formula | C6H4O4 |
| Molecular Weight | 140.0936 |
| Density | 1.843g/cm3 |
| Melting point | 220℃ |
| Boiling point | 322.3°C at 760 mmHg |
| Flash point | 162.9°C |
| Refractive index | 1.729 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
615-94-1 2,5-dihydroxy-1,4-benzoquinone
service@apichina.com