| Product Name | 2,5-difluoropropiophenone |
| CAS No. | 29112-90-1 |
| Synonyms | 2',5'-Difluoropropiophenone; 1-(2,5-difluorophenyl)propan-1-one |
| InChI | InChI=1/C9H8F2O/c1-2-9(12)7-5-6(10)3-4-8(7)11/h3-5H,2H2,1H3 |
| Molecular Formula | C9H8F2O |
| Molecular Weight | 170.156 |
| Density | 1.166g/cm3 |
| Boiling point | 210.6°C at 760 mmHg |
| Flash point | 78.8°C |
| Refractive index | 1.472 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
29112-90-1 2,5-difluoropropiophenone
service@apichina.com